C27H27FN4O2S — CID 171735009
1,4-diazepan-1-yl-[4-(3-fluoro-4-isocyanophenyl)-5-[4-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]thiophen-2-yl]methanone (PubChem CID 171735009) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[4-(3-fluoro-4-isocyanophenyl)-5-[4-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]thiophen-2-yl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[4-(3-fluoro-4-isocyanophenyl)-5-[4-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 171735009 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1,4-diazepan-1-yl-[4-(3-fluoro-4-isocyanophenyl)-5-[4-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]thiophen-2-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(-c2cc(C(=O)N3CCCNCC3)sc2-c2ccc(N3CC[C@H](O)C3)cc2)cc1F |
| InChI | InChI=1S/C27H27FN4O2S/c1-29-24-8-5-19(15-23(24)28)22-16-25(27(34)31-12-2-10-30-11-14-31)35-26(22)18-3-6-20(7-4-18)32-13-9-21(33)17-32/h3-8,15-16,21,30,33H,2,9-14,17H2/t21-/m0/s1 |
| InChIKey | QWGPSZUILWPZNW-NRFANRHFSA-N |
| XLogP | 4.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|