C28H26F2N4O — CID 159558412
6-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one (PubChem CID 159558412) has the molecular formula C28H26F2N4O and a molecular weight of 472.54 g/mol. Its IUPAC name is 6-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one.
| Compound Name | 6-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 159558412 |
| Molecular Formula | C28H26F2N4O |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 6-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC4CCCC4C3)c(F)c(=O)n2-c2ccc(C3CC3)cc2)cc1F |
| InChI | InChI=1S/C28H26F2N4O/c1-31-24-12-9-20(15-23(24)29)26-32-27(33-14-13-17-3-2-4-21(17)16-33)25(30)28(35)34(26)22-10-7-19(8-11-22)18-5-6-18/h7-12,15,17-18,21H,2-6,13-14,16H2 |
| InChIKey | MGHFQVHLYLGPRD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 42.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|