C26H25F2N5O2 — CID 118633071
4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-1-(3-fluoro-4-methoxyphenyl)-5-methyl-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile (PubChem CID 118633071) has the molecular formula C26H25F2N5O2 and a molecular weight of 477.52 g/mol. Its IUPAC name is 4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-1-(3-fluoro-4-methoxyphenyl)-5-methyl-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-1-(3-fluoro-4-methoxyphenyl)-5-methyl-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 118633071 |
| Molecular Formula | C26H25F2N5O2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-1-(3-fluoro-4-methoxyphenyl)-5-methyl-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile |
| SMILES | COc1ccc(-n2c(-c3ccc(C#N)c(F)c3)nc(N3CCC4CNCC4C3)c(C)c2=O)cc1F |
| InChI | InChI=1S/C26H25F2N5O2/c1-15-24(32-8-7-18-12-30-13-19(18)14-32)31-25(16-3-4-17(11-29)21(27)9-16)33(26(15)34)20-5-6-23(35-2)22(28)10-20/h3-6,9-10,18-19,30H,7-8,12-14H2,1-2H3 |
| InChIKey | JQWXTEJEZUKNGP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |