C18H11F2N3O3 — CID 118626615
2-(4-cyano-3-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)imidazole-4-carboxylic acid (PubChem CID 118626615) has the molecular formula C18H11F2N3O3 and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-(4-cyano-3-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)imidazole-4-carboxylic acid.
| Compound Name | 2-(4-cyano-3-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 118626615 |
| Molecular Formula | C18H11F2N3O3 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(4-cyano-3-fluorophenyl)-1-(3-fluoro-4-methoxyphenyl)imidazole-4-carboxylic acid |
| SMILES | COc1ccc(-n2cc(C(=O)O)nc2-c2ccc(C#N)c(F)c2)cc1F |
| InChI | InChI=1S/C18H11F2N3O3/c1-26-16-5-4-12(7-14(16)20)23-9-15(18(24)25)22-17(23)10-2-3-11(8-21)13(19)6-10/h2-7,9H,1H3,(H,24,25) |
| InChIKey | SUGOGTMLWMENLE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |