C19H11F2NO3S — CID 171735132
4-(4-cyano-3-fluorophenyl)-5-(3-fluoro-4-methoxyphenyl)thiophene-2-carboxylic acid (PubChem CID 171735132) has the molecular formula C19H11F2NO3S and a molecular weight of 371.36 g/mol. Its IUPAC name is 4-(4-cyano-3-fluorophenyl)-5-(3-fluoro-4-methoxyphenyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(4-cyano-3-fluorophenyl)-5-(3-fluoro-4-methoxyphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 171735132 |
| Molecular Formula | C19H11F2NO3S |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 4-(4-cyano-3-fluorophenyl)-5-(3-fluoro-4-methoxyphenyl)thiophene-2-carboxylic acid |
| SMILES | COc1ccc(-c2sc(C(=O)O)cc2-c2ccc(C#N)c(F)c2)cc1F |
| InChI | InChI=1S/C19H11F2NO3S/c1-25-16-5-4-11(7-15(16)21)18-13(8-17(26-18)19(23)24)10-2-3-12(9-22)14(20)6-10/h2-8H,1H3,(H,23,24) |
| InChIKey | AWXBYICKDXEIMU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |