C19H13FN2O3Se — CID 139208043
2-[3-cyano-4-(3-fluoro-4-methoxyphenyl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid (PubChem CID 139208043) has the molecular formula C19H13FN2O3Se and a molecular weight of 415.28 g/mol. Its IUPAC name is 2-[3-cyano-4-(3-fluoro-4-methoxyphenyl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid.
| Compound Name | 2-[3-cyano-4-(3-fluoro-4-methoxyphenyl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid |
|---|---|
| PubChem CID | 139208043 |
| Molecular Formula | C19H13FN2O3Se |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 2-[3-cyano-4-(3-fluoro-4-methoxyphenyl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2ccc(-c3nc(C)c(C(=O)O)[se]3)cc2C#N)cc1F |
| InChI | InChI=1S/C19H13FN2O3Se/c1-10-17(19(23)24)26-18(22-10)12-3-5-14(13(7-12)9-21)11-4-6-16(25-2)15(20)8-11/h3-8H,1-2H3,(H,23,24) |
| InChIKey | CNZVTBICZKIRLX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|