C18H20N4O2Se — CID 73387519
2-[3-cyano-4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid (PubChem CID 73387519) has the molecular formula C18H20N4O2Se and a molecular weight of 403.34 g/mol. Its IUPAC name is 2-[3-cyano-4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid.
| Compound Name | 2-[3-cyano-4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid |
|---|---|
| PubChem CID | 73387519 |
| Molecular Formula | C18H20N4O2Se |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[3-cyano-4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid |
| SMILES | CCN1CCN(c2ccc(-c3nc(C)c(C(=O)O)[se]3)cc2C#N)CC1 |
| InChI | InChI=1S/C18H20N4O2Se/c1-3-21-6-8-22(9-7-21)15-5-4-13(10-14(15)11-19)17-20-12(2)16(25-17)18(23)24/h4-5,10H,3,6-9H2,1-2H3,(H,23,24) |
| InChIKey | VOBZEWAWNXABBI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|