C17H14N2O3Se — CID 141472059
2-[7-cyano-2-(1,2-dideuteriopropan-2-yl)-1-benzofuran-5-yl]-4-methyl-1,3-selenazole-5-carboxylic acid (PubChem CID 141472059) has the molecular formula C17H14N2O3Se and a molecular weight of 375.28 g/mol. Its IUPAC name is 2-[7-cyano-2-(1,2-dideuteriopropan-2-yl)-1-benzofuran-5-yl]-4-methyl-1,3-selenazole-5-carboxylic acid.
| Compound Name | 2-[7-cyano-2-(1,2-dideuteriopropan-2-yl)-1-benzofuran-5-yl]-4-methyl-1,3-selenazole-5-carboxylic acid |
|---|---|
| PubChem CID | 141472059 |
| Molecular Formula | C17H14N2O3Se |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[7-cyano-2-(1,2-dideuteriopropan-2-yl)-1-benzofuran-5-yl]-4-methyl-1,3-selenazole-5-carboxylic acid |
| SMILES | [2H]CC([2H])(C)c1cc2cc(-c3nc(C)c(C(=O)O)[se]3)cc(C#N)c2o1 |
| InChI | InChI=1S/C17H14N2O3Se/c1-8(2)13-6-10-4-11(5-12(7-18)14(10)22-13)16-19-9(3)15(23-16)17(20)21/h4-6,8H,1-3H3,(H,20,21)/i1D,8D |
| InChIKey | IUHPSFADBMDKDA-NRIOPPFLSA-N |
| XLogP | 3.55 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|