C19H15N3O2SSe — CID 144634503
2-[3-cyano-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid (PubChem CID 144634503) has the molecular formula C19H15N3O2SSe and a molecular weight of 428.38 g/mol. Its IUPAC name is 2-[3-cyano-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid.
| Compound Name | 2-[3-cyano-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid |
|---|---|
| PubChem CID | 144634503 |
| Molecular Formula | C19H15N3O2SSe |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 2-[3-cyano-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-4-methyl-1,3-selenazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(N3CCc4sccc4C3)c(C#N)c2)[se]c1C(=O)O |
| InChI | InChI=1S/C19H15N3O2SSe/c1-11-17(19(23)24)26-18(21-11)12-2-3-15(14(8-12)9-20)22-6-4-16-13(10-22)5-7-25-16/h2-3,5,7-8H,4,6,10H2,1H3,(H,23,24) |
| InChIKey | DDXMMUJSYYKEDK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|