C15H13BrN2S — CID 114063518
5-(bromomethyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzonitrile (PubChem CID 114063518) has the molecular formula C15H13BrN2S and a molecular weight of 333.25 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzonitrile.
| Compound Name | 5-(bromomethyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 114063518 |
| Molecular Formula | C15H13BrN2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 5-(bromomethyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzonitrile |
| SMILES | N#Cc1cc(CBr)ccc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C15H13BrN2S/c16-8-11-1-2-14(13(7-11)9-17)18-5-3-15-12(10-18)4-6-19-15/h1-2,4,6-7H,3,5,8,10H2 |
| InChIKey | DMMDPROEQLSYFB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|