C17H16N2O3Se — CID 85469749
ethyl 2-(3-cyano-4-prop-2-enoxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate (PubChem CID 85469749) has the molecular formula C17H16N2O3Se and a molecular weight of 375.29 g/mol. Its IUPAC name is ethyl 2-(3-cyano-4-prop-2-enoxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate.
| Compound Name | ethyl 2-(3-cyano-4-prop-2-enoxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate |
|---|---|
| PubChem CID | 85469749 |
| Molecular Formula | C17H16N2O3Se |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | ethyl 2-(3-cyano-4-prop-2-enoxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate |
| SMILES | C=CCOc1ccc(-c2nc(C)c(C(=O)OCC)[se]2)cc1C#N |
| InChI | InChI=1S/C17H16N2O3Se/c1-4-8-22-14-7-6-12(9-13(14)10-18)16-19-11(3)15(23-16)17(20)21-5-2/h4,6-7,9H,1,5,8H2,2-3H3 |
| InChIKey | BLDHPSNWDUSVPS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|