C13H10N2OS — CID 174560732
2-prop-2-enoxy-5-(1,3-thiazol-2-yl)benzonitrile (PubChem CID 174560732) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-prop-2-enoxy-5-(1,3-thiazol-2-yl)benzonitrile.
| Compound Name | 2-prop-2-enoxy-5-(1,3-thiazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 174560732 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-prop-2-enoxy-5-(1,3-thiazol-2-yl)benzonitrile |
| SMILES | C=CCOc1ccc(-c2nccs2)cc1C#N |
| InChI | InChI=1S/C13H10N2OS/c1-2-6-16-12-4-3-10(8-11(12)9-14)13-15-5-7-17-13/h2-5,7-8H,1,6H2 |
| InChIKey | VEZGODNGRXUDTQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|