C13H11BrClNO2Se — CID 141349034
ethyl 2-(3-bromo-4-chlorophenyl)-4-methyl-1,3-selenazole-5-carboxylate (PubChem CID 141349034) has the molecular formula C13H11BrClNO2Se and a molecular weight of 407.55 g/mol. Its IUPAC name is ethyl 2-(3-bromo-4-chlorophenyl)-4-methyl-1,3-selenazole-5-carboxylate.
| Compound Name | ethyl 2-(3-bromo-4-chlorophenyl)-4-methyl-1,3-selenazole-5-carboxylate |
|---|---|
| PubChem CID | 141349034 |
| Molecular Formula | C13H11BrClNO2Se |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 406.88 |
| IUPAC Name | ethyl 2-(3-bromo-4-chlorophenyl)-4-methyl-1,3-selenazole-5-carboxylate |
| SMILES | CCOC(=O)c1[se]c(-c2ccc(Cl)c(Br)c2)nc1C |
| InChI | InChI=1S/C13H11BrClNO2Se/c1-3-18-13(17)11-7(2)16-12(19-11)8-4-5-10(15)9(14)6-8/h4-6H,3H2,1-2H3 |
| InChIKey | PTVDELJKUSXUKN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|