C18H19BrN2O3Se — CID 140693675
ethyl 4-(bromomethyl)-2-[3-isocyano-4-(2-methylpropoxy)phenyl]-1,3-selenazole-5-carboxylate (PubChem CID 140693675) has the molecular formula C18H19BrN2O3Se and a molecular weight of 470.23 g/mol. Its IUPAC name is ethyl 4-(bromomethyl)-2-[3-isocyano-4-(2-methylpropoxy)phenyl]-1,3-selenazole-5-carboxylate.
| Compound Name | ethyl 4-(bromomethyl)-2-[3-isocyano-4-(2-methylpropoxy)phenyl]-1,3-selenazole-5-carboxylate |
|---|---|
| PubChem CID | 140693675 |
| Molecular Formula | C18H19BrN2O3Se |
| Molecular Weight | 470.23 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | ethyl 4-(bromomethyl)-2-[3-isocyano-4-(2-methylpropoxy)phenyl]-1,3-selenazole-5-carboxylate |
| SMILES | [C-]#[N+]c1cc(-c2nc(CBr)c(C(=O)OCC)[se]2)ccc1OCC(C)C |
| InChI | InChI=1S/C18H19BrN2O3Se/c1-5-23-18(22)16-14(9-19)21-17(25-16)12-6-7-15(13(8-12)20-4)24-10-11(2)3/h6-8,11H,5,9-10H2,1-3H3 |
| InChIKey | WZZPRTZZWACYJZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|