C40H54O8 — CID 22146246
diethyl 2,5-bis[3,4-bis(2-methylpropoxy)phenyl]benzene-1,4-dicarboxylate (PubChem CID 22146246) has the molecular formula C40H54O8 and a molecular weight of 662.86 g/mol. Its IUPAC name is diethyl 2,5-bis[3,4-bis(2-methylpropoxy)phenyl]benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[3,4-bis(2-methylpropoxy)phenyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22146246 |
| Molecular Formula | C40H54O8 |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | diethyl 2,5-bis[3,4-bis(2-methylpropoxy)phenyl]benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(OCC(C)C)c(OCC(C)C)c2)c(C(=O)OCC)cc1-c1ccc(OCC(C)C)c(OCC(C)C)c1 |
| InChI | InChI=1S/C40H54O8/c1-11-43-39(41)33-19-32(30-14-16-36(46-22-26(5)6)38(18-30)48-24-28(9)10)34(40(42)44-12-2)20-31(33)29-13-15-35(45-21-25(3)4)37(17-29)47-23-27(7)8/h13-20,25-28H,11-12,21-24H2,1-10H3 |
| InChIKey | BKMLFDFRZBRURP-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |