C19H20N2O3 — CID 68702096
ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]pyridine-3-carboxylate (PubChem CID 68702096) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68702096 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1-c1ccc(OCC(C)C)c(C#N)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-4-23-19(22)16-6-5-9-21-18(16)14-7-8-17(15(10-14)11-20)24-12-13(2)3/h5-10,13H,4,12H2,1-3H3 |
| InChIKey | NQCISACZRNHFQQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |