C26H26N2O4 — CID 68703730
ethyl 2-[3-cyano-4-[2-(4-methoxyphenyl)-2-methylpropoxy]phenyl]pyridine-3-carboxylate (PubChem CID 68703730) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is ethyl 2-[3-cyano-4-[2-(4-methoxyphenyl)-2-methylpropoxy]phenyl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[3-cyano-4-[2-(4-methoxyphenyl)-2-methylpropoxy]phenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68703730 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl 2-[3-cyano-4-[2-(4-methoxyphenyl)-2-methylpropoxy]phenyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1-c1ccc(OCC(C)(C)c2ccc(OC)cc2)c(C#N)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-5-31-25(29)22-7-6-14-28-24(22)18-8-13-23(19(15-18)16-27)32-17-26(2,3)20-9-11-21(30-4)12-10-20/h6-15H,5,17H2,1-4H3 |
| InChIKey | IPGWWOWAPDQSAE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |