C23H15Cl2F3N2O5 — CID 68704440
2-[3-cyano-4-[3-[2,6-dichloro-4-(trifluoromethoxy)phenoxy]propoxy]phenyl]pyridine-3-carboxylic acid (PubChem CID 68704440) has the molecular formula C23H15Cl2F3N2O5 and a molecular weight of 527.28 g/mol. Its IUPAC name is 2-[3-cyano-4-[3-[2,6-dichloro-4-(trifluoromethoxy)phenoxy]propoxy]phenyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[3-cyano-4-[3-[2,6-dichloro-4-(trifluoromethoxy)phenoxy]propoxy]phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 68704440 |
| Molecular Formula | C23H15Cl2F3N2O5 |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | 2-[3-cyano-4-[3-[2,6-dichloro-4-(trifluoromethoxy)phenoxy]propoxy]phenyl]pyridine-3-carboxylic acid |
| SMILES | N#Cc1cc(-c2ncccc2C(=O)O)ccc1OCCCOc1c(Cl)cc(OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C23H15Cl2F3N2O5/c24-17-10-15(35-23(26,27)28)11-18(25)21(17)34-8-2-7-33-19-5-4-13(9-14(19)12-29)20-16(22(31)32)3-1-6-30-20/h1,3-6,9-11H,2,7-8H2,(H,31,32) |
| InChIKey | TVSLXRKHOWHCGB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|