C23H17Cl2F3N2O5 — CID 24959478
2-[3-cyano-4-[3-(2,6-dichloro-3,4,5-trifluoro-6-methoxycyclohexa-1,3-dien-1-yl)oxypropoxy]phenyl]pyridine-3-carboxylic acid (PubChem CID 24959478) has the molecular formula C23H17Cl2F3N2O5 and a molecular weight of 529.30 g/mol. Its IUPAC name is 2-[3-cyano-4-[3-(2,6-dichloro-3,4,5-trifluoro-6-methoxycyclohexa-1,3-dien-1-yl)oxypropoxy]phenyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[3-cyano-4-[3-(2,6-dichloro-3,4,5-trifluoro-6-methoxycyclohexa-1,3-dien-1-yl)oxypropoxy]phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 24959478 |
| Molecular Formula | C23H17Cl2F3N2O5 |
| Molecular Weight | 529.30 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 2-[3-cyano-4-[3-(2,6-dichloro-3,4,5-trifluoro-6-methoxycyclohexa-1,3-dien-1-yl)oxypropoxy]phenyl]pyridine-3-carboxylic acid |
| SMILES | COC1(Cl)C(OCCCOc2ccc(-c3ncccc3C(=O)O)cc2C#N)=C(Cl)C(F)=C(F)C1F |
| InChI | InChI=1S/C23H17Cl2F3N2O5/c1-33-23(25)20(28)18(27)17(26)16(24)21(23)35-9-3-8-34-15-6-5-12(10-13(15)11-29)19-14(22(31)32)4-2-7-30-19/h2,4-7,10,20H,3,8-9H2,1H3,(H,31,32) |
| InChIKey | ARBHECVMHVAXBL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|