C14H10F3NO3 — CID 67521270
2-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid (PubChem CID 67521270) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 2-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67521270 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F3NO3/c15-14(16,17)21-10-5-3-9(4-6-10)8-12-11(13(19)20)2-1-7-18-12/h1-7H,8H2,(H,19,20) |
| InChIKey | MKDJTXMDYWWWHW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |