C17H17NO7 — CID 66808540
2-benzylpyridine-3-carboxylic acid;2-hydroxybutanedioic acid (PubChem CID 66808540) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-benzylpyridine-3-carboxylic acid;2-hydroxybutanedioic acid.
| Compound Name | 2-benzylpyridine-3-carboxylic acid;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 66808540 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-benzylpyridine-3-carboxylic acid;2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)C(=O)O.O=C(O)c1cccnc1Cc1ccccc1 |
| InChI | InChI=1S/C13H11NO2.C4H6O5/c15-13(16)11-7-4-8-14-12(11)9-10-5-2-1-3-6-10;5-2(4(8)9)1-3(6)7/h1-8H,9H2,(H,15,16);2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | LTMFNOPHETWDRM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |