About ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate
ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate (PubChem CID 51347664) has the molecular formula C17H19NO5S
and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate |
| PubChem CID | 51347664 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccc(OCC(C)C)c(OC=O)c2)s1 |
| InChI | InChI=1S/C17H19NO5S/c1-4-21-17(20)15-8-18-16(24-15)12-5-6-13(22-9-11(2)3)14(7-12)23-10-19/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | CFKNWCYILYNZRN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate (CID 51347664) is ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate is CCOC(=O)c1cnc(-c2ccc(OCC(C)C)c(OC=O)c2)s1.
What is the InChIKey of ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate?
The InChIKey is CFKNWCYILYNZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO5S/c1-4-21-17(20)15-8-18-16(24-15)12-5-6-13(22-9-11(2)3)14(7-12)23-10-19/h5-8,10-11H,4,9H2,1-3H3.
What are the key properties of ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate?
ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate has a molecular weight of 349.41 g/mol, XLogP of 3.56, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-formyloxy-4-(2-methylpropoxy)phenyl]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 51347664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).