C17H15N3O2S — CID 68753427
ethyl 2-(3-cyano-1-ethylindol-5-yl)-1,3-thiazole-5-carboxylate (PubChem CID 68753427) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is ethyl 2-(3-cyano-1-ethylindol-5-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(3-cyano-1-ethylindol-5-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 68753427 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | ethyl 2-(3-cyano-1-ethylindol-5-yl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccc3c(c2)c(C#N)cn3CC)s1 |
| InChI | InChI=1S/C17H15N3O2S/c1-3-20-10-12(8-18)13-7-11(5-6-14(13)20)16-19-9-15(23-16)17(21)22-4-2/h5-7,9-10H,3-4H2,1-2H3 |
| InChIKey | GCUJNNUIMTZQKD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |