C14H12N2O3Se — CID 140693700
ethyl 2-(4-hydroxy-3-isocyanophenyl)-4-methyl-1,3-selenazole-5-carboxylate (PubChem CID 140693700) has the molecular formula C14H12N2O3Se and a molecular weight of 335.22 g/mol. Its IUPAC name is ethyl 2-(4-hydroxy-3-isocyanophenyl)-4-methyl-1,3-selenazole-5-carboxylate.
| Compound Name | ethyl 2-(4-hydroxy-3-isocyanophenyl)-4-methyl-1,3-selenazole-5-carboxylate |
|---|---|
| PubChem CID | 140693700 |
| Molecular Formula | C14H12N2O3Se |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | ethyl 2-(4-hydroxy-3-isocyanophenyl)-4-methyl-1,3-selenazole-5-carboxylate |
| SMILES | [C-]#[N+]c1cc(-c2nc(C)c(C(=O)OCC)[se]2)ccc1O |
| InChI | InChI=1S/C14H12N2O3Se/c1-4-19-14(18)12-8(2)16-13(20-12)9-5-6-11(17)10(7-9)15-3/h5-7,17H,4H2,1-2H3 |
| InChIKey | HUFOKEGOCFZAGY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|