C13H12BrNO3Se — CID 140693694
ethyl 2-(3-bromo-4-hydroxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate (PubChem CID 140693694) has the molecular formula C13H12BrNO3Se and a molecular weight of 389.11 g/mol. Its IUPAC name is ethyl 2-(3-bromo-4-hydroxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate.
| Compound Name | ethyl 2-(3-bromo-4-hydroxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate |
|---|---|
| PubChem CID | 140693694 |
| Molecular Formula | C13H12BrNO3Se |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | ethyl 2-(3-bromo-4-hydroxyphenyl)-4-methyl-1,3-selenazole-5-carboxylate |
| SMILES | CCOC(=O)c1[se]c(-c2ccc(O)c(Br)c2)nc1C |
| InChI | InChI=1S/C13H12BrNO3Se/c1-3-18-13(17)11-7(2)15-12(19-11)8-4-5-10(16)9(14)6-8/h4-6,16H,3H2,1-2H3 |
| InChIKey | KZSNNSBSORSDRQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|