C19H12Br4N2O2 — CID 171775930
ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate (PubChem CID 171775930) has the molecular formula C19H12Br4N2O2 and a molecular weight of 619.93 g/mol. Its IUPAC name is ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate.
| Compound Name | ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 171775930 |
| Molecular Formula | C19H12Br4N2O2 |
| Molecular Weight | 619.93 g/mol |
| Exact Mass | 615.76 |
| IUPAC Name | ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(Br)c(Br)c2)nc(-c2ccc(Br)c(Br)c2)n1 |
| InChI | InChI=1S/C19H12Br4N2O2/c1-2-27-19(26)17-9-16(10-3-5-12(20)14(22)7-10)24-18(25-17)11-4-6-13(21)15(23)8-11/h3-9H,2H2,1H3 |
| InChIKey | BEISRHHEEXXZRN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.93 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |