ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate

C19H12Br4N2O2 — CID 171775930

IUPACethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate
SMILESCCOC(=O)c1cc(-c2ccc(Br)c(Br)c2)nc(-c2ccc(Br)c(Br)c2)n1
InChIInChI=1S/C19H12Br4N2O2/c1-2-27-19(26)17-9-16(10-3-5-12(20)14(22)7-10)24-18(25-17)11-4-6-13(21)15(23)8-11/h3-9H,2H2,1H3
InChIKeyBEISRHHEEXXZRN-UHFFFAOYSA-N
MW619.93 g/mol
LogP7.04
Rot. Bonds4

About ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate

ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate (PubChem CID 171775930) has the molecular formula C19H12Br4N2O2 and a molecular weight of 619.93 g/mol. Its IUPAC name is ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate.

Molecular Properties

Compound Nameethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate
PubChem CID171775930
Molecular FormulaC19H12Br4N2O2
Molecular Weight619.93 g/mol
Exact Mass615.76
IUPAC Nameethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate
SMILESCCOC(=O)c1cc(-c2ccc(Br)c(Br)c2)nc(-c2ccc(Br)c(Br)c2)n1
InChIInChI=1S/C19H12Br4N2O2/c1-2-27-19(26)17-9-16(10-3-5-12(20)14(22)7-10)24-18(25-17)11-4-6-13(21)15(23)8-11/h3-9H,2H2,1H3
InChIKeyBEISRHHEEXXZRN-UHFFFAOYSA-N
XLogP7.04
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500619.93
LogP ≤ 57.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate?
The IUPAC name of ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate (CID 171775930) is ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate.
What is the SMILES notation for ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate?
The canonical SMILES for ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate is CCOC(=O)c1cc(-c2ccc(Br)c(Br)c2)nc(-c2ccc(Br)c(Br)c2)n1.
What is the InChIKey of ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate?
The InChIKey is BEISRHHEEXXZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Br4N2O2/c1-2-27-19(26)17-9-16(10-3-5-12(20)14(22)7-10)24-18(25-17)11-4-6-13(21)15(23)8-11/h3-9H,2H2,1H3.
What are the key properties of ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate?
ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate has a molecular weight of 619.93 g/mol, XLogP of 7.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,6-bis(3,4-dibromophenyl)pyrimidine-4-carboxylate is sourced from PubChem (CID 171775930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).