C15H14FNO3S — CID 110447088
(E)-3-[4-(3-fluoro-4-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]but-2-enoic acid (PubChem CID 110447088) has the molecular formula C15H14FNO3S and a molecular weight of 307.35 g/mol. Its IUPAC name is (E)-3-[4-(3-fluoro-4-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]but-2-enoic acid.
| Compound Name | (E)-3-[4-(3-fluoro-4-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 110447088 |
| Molecular Formula | C15H14FNO3S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (E)-3-[4-(3-fluoro-4-methoxyphenyl)-2-methyl-1,3-thiazol-5-yl]but-2-enoic acid |
| SMILES | COc1ccc(-c2nc(C)sc2/C(C)=C/C(=O)O)cc1F |
| InChI | InChI=1S/C15H14FNO3S/c1-8(6-13(18)19)15-14(17-9(2)21-15)10-4-5-12(20-3)11(16)7-10/h4-7H,1-3H3,(H,18,19)/b8-6+ |
| InChIKey | XIQZYIBXQCXESH-SOFGYWHQSA-N |
| XLogP | 3.75 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|