C15H13NO4S — CID 110447066
4-[5-[(E)-1-carboxyprop-1-en-2-yl]-2-methyl-1,3-thiazol-4-yl]benzoic acid (PubChem CID 110447066) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 4-[5-[(E)-1-carboxyprop-1-en-2-yl]-2-methyl-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 4-[5-[(E)-1-carboxyprop-1-en-2-yl]-2-methyl-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 110447066 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 4-[5-[(E)-1-carboxyprop-1-en-2-yl]-2-methyl-1,3-thiazol-4-yl]benzoic acid |
| SMILES | C/C(=C\C(=O)O)c1sc(C)nc1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H13NO4S/c1-8(7-12(17)18)14-13(16-9(2)21-14)10-3-5-11(6-4-10)15(19)20/h3-7H,1-2H3,(H,17,18)(H,19,20)/b8-7+ |
| InChIKey | OTOLUPAIBKVPHZ-BQYQJAHWSA-N |
| XLogP | 3.30 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|