C13H16F3N3 — CID 162745525
2-(azetidin-3-yl)-5-[3-(trifluoromethyl)pyrrolidin-1-yl]pyridine (PubChem CID 162745525) has the molecular formula C13H16F3N3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-5-[3-(trifluoromethyl)pyrrolidin-1-yl]pyridine.
| Compound Name | 2-(azetidin-3-yl)-5-[3-(trifluoromethyl)pyrrolidin-1-yl]pyridine |
|---|---|
| PubChem CID | 162745525 |
| Molecular Formula | C13H16F3N3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-(azetidin-3-yl)-5-[3-(trifluoromethyl)pyrrolidin-1-yl]pyridine |
| SMILES | FC(F)(F)C1CCN(c2ccc(C3CNC3)nc2)C1 |
| InChI | InChI=1S/C13H16F3N3/c14-13(15,16)10-3-4-19(8-10)11-1-2-12(18-7-11)9-5-17-6-9/h1-2,7,9-10,17H,3-6,8H2 |
| InChIKey | QUBDXYNIUXCPHT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |