C10H12F3N3 — CID 129320766
6-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]pyridin-3-amine (PubChem CID 129320766) has the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. Its IUPAC name is 6-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]pyridin-3-amine.
| Compound Name | 6-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 129320766 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 6-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CC[C@@H](C(F)(F)F)C2)nc1 |
| InChI | InChI=1S/C10H12F3N3/c11-10(12,13)7-3-4-16(6-7)9-2-1-8(14)5-15-9/h1-2,5,7H,3-4,6,14H2/t7-/m1/s1 |
| InChIKey | MKFDGQQTFATWIN-SSDOTTSWSA-N |
| XLogP | 2.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |