C11H16FN3 — CID 121200980
6-[3-(fluoromethyl)piperidin-1-yl]pyridin-3-amine (PubChem CID 121200980) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-[3-(fluoromethyl)piperidin-1-yl]pyridin-3-amine.
| Compound Name | 6-[3-(fluoromethyl)piperidin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 121200980 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 6-[3-(fluoromethyl)piperidin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCCC(CF)C2)nc1 |
| InChI | InChI=1S/C11H16FN3/c12-6-9-2-1-5-15(8-9)11-4-3-10(13)7-14-11/h3-4,7,9H,1-2,5-6,8,13H2 |
| InChIKey | LETSHYKQTWILOP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |