C10H13F3N4 — CID 107589799
1-pyrimidin-5-yl-6-(trifluoromethyl)-1,4-diazepane (PubChem CID 107589799) has the molecular formula C10H13F3N4 and a molecular weight of 246.24 g/mol. Its IUPAC name is 1-pyrimidin-5-yl-6-(trifluoromethyl)-1,4-diazepane.
| Compound Name | 1-pyrimidin-5-yl-6-(trifluoromethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 107589799 |
| Molecular Formula | C10H13F3N4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-pyrimidin-5-yl-6-(trifluoromethyl)-1,4-diazepane |
| SMILES | FC(F)(F)C1CNCCN(c2cncnc2)C1 |
| InChI | InChI=1S/C10H13F3N4/c11-10(12,13)8-3-14-1-2-17(6-8)9-4-15-7-16-5-9/h4-5,7-8,14H,1-3,6H2 |
| InChIKey | ZIQPYYZEQZQTJA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |