C13H16F4N2 — CID 103372145
1-(2-fluoro-6-methylphenyl)-6-(trifluoromethyl)-1,4-diazepane (PubChem CID 103372145) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-(2-fluoro-6-methylphenyl)-6-(trifluoromethyl)-1,4-diazepane.
| Compound Name | 1-(2-fluoro-6-methylphenyl)-6-(trifluoromethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 103372145 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-(2-fluoro-6-methylphenyl)-6-(trifluoromethyl)-1,4-diazepane |
| SMILES | Cc1cccc(F)c1N1CCNCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H16F4N2/c1-9-3-2-4-11(14)12(9)19-6-5-18-7-10(8-19)13(15,16)17/h2-4,10,18H,5-8H2,1H3 |
| InChIKey | ZSMPSUFWWTYKPH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |