C12H15F3N2O — CID 84729581
2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol (PubChem CID 84729581) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol.
| Compound Name | 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol |
|---|---|
| PubChem CID | 84729581 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol |
| SMILES | Oc1ccccc1N1CCNCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)9-7-16-5-6-17(8-9)10-3-1-2-4-11(10)18/h1-4,9,16,18H,5-8H2 |
| InChIKey | GZYXBFYIGYTMOL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |