About 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol
2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol (PubChem CID 84729581) has the molecular formula C12H15F3N2O
and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol.
Molecular Properties
| Compound Name | 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol |
| PubChem CID | 84729581 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol |
| SMILES | Oc1ccccc1N1CCNCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)9-7-16-5-6-17(8-9)10-3-1-2-4-11(10)18/h1-4,9,16,18H,5-8H2 |
| InChIKey | GZYXBFYIGYTMOL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol?
The IUPAC name of 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol (CID 84729581) is 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol.
What is the SMILES notation for 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol?
The canonical SMILES for 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol is Oc1ccccc1N1CCNCC(C(F)(F)F)C1.
What is the InChIKey of 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol?
The InChIKey is GZYXBFYIGYTMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O/c13-12(14,15)9-7-16-5-6-17(8-9)10-3-1-2-4-11(10)18/h1-4,9,16,18H,5-8H2.
What are the key properties of 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol?
2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol has a molecular weight of 260.26 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(trifluoromethyl)-1,4-diazepan-1-yl]phenol is sourced from PubChem (CID 84729581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).