C12H13F5N2 — CID 103371862
1-(2,5-difluorophenyl)-6-(trifluoromethyl)-1,4-diazepane (PubChem CID 103371862) has the molecular formula C12H13F5N2 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-6-(trifluoromethyl)-1,4-diazepane.
| Compound Name | 1-(2,5-difluorophenyl)-6-(trifluoromethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 103371862 |
| Molecular Formula | C12H13F5N2 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)-6-(trifluoromethyl)-1,4-diazepane |
| SMILES | Fc1ccc(F)c(N2CCNCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C12H13F5N2/c13-9-1-2-10(14)11(5-9)19-4-3-18-6-8(7-19)12(15,16)17/h1-2,5,8,18H,3-4,6-7H2 |
| InChIKey | FQURSPFHKFBSRP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |