C9H9BF3N3 — CID 123785451
CID 123785451 (PubChem CID 123785451) has the molecular formula C9H9BF3N3 and a molecular weight of 227.00 g/mol.
| Compound Name | CID 123785451 |
|---|---|
| PubChem CID | 123785451 |
| Molecular Formula | C9H9BF3N3 |
| Molecular Weight | 227.00 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(N2CCC(C(F)(F)F)C2)nc1 |
| InChI | InChI=1S/C9H9BF3N3/c10-7-3-14-8(15-4-7)16-2-1-6(5-16)9(11,12)13/h3-4,6H,1-2,5H2 |
| InChIKey | SNZGPEHVPIZLMB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.00 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|