C19H17FN6O3 — CID 140869129
[1-[5-cyano-4-(4-cyano-3-fluorophenyl)-1-methyl-6-oxopyrimidin-2-yl]piperidin-4-yl]carbamic acid (PubChem CID 140869129) has the molecular formula C19H17FN6O3 and a molecular weight of 396.38 g/mol. Its IUPAC name is [1-[5-cyano-4-(4-cyano-3-fluorophenyl)-1-methyl-6-oxopyrimidin-2-yl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[5-cyano-4-(4-cyano-3-fluorophenyl)-1-methyl-6-oxopyrimidin-2-yl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 140869129 |
| Molecular Formula | C19H17FN6O3 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [1-[5-cyano-4-(4-cyano-3-fluorophenyl)-1-methyl-6-oxopyrimidin-2-yl]piperidin-4-yl]carbamic acid |
| SMILES | Cn1c(N2CCC(NC(=O)O)CC2)nc(-c2ccc(C#N)c(F)c2)c(C#N)c1=O |
| InChI | InChI=1S/C19H17FN6O3/c1-25-17(27)14(10-22)16(11-2-3-12(9-21)15(20)8-11)24-18(25)26-6-4-13(5-7-26)23-19(28)29/h2-3,8,13,23H,4-7H2,1H3,(H,28,29) |
| InChIKey | FNRWGRJQHAPUTD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|