C19H15ClFN3O3 — CID 135339524
[(3S)-1-[4-chloro-3-(4-cyano-3-fluorophenyl)benzoyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 135339524) has the molecular formula C19H15ClFN3O3 and a molecular weight of 387.80 g/mol. Its IUPAC name is [(3S)-1-[4-chloro-3-(4-cyano-3-fluorophenyl)benzoyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3S)-1-[4-chloro-3-(4-cyano-3-fluorophenyl)benzoyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 135339524 |
| Molecular Formula | C19H15ClFN3O3 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [(3S)-1-[4-chloro-3-(4-cyano-3-fluorophenyl)benzoyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | N#Cc1ccc(-c2cc(C(=O)N3CC[C@H](NC(=O)O)C3)ccc2Cl)cc1F |
| InChI | InChI=1S/C19H15ClFN3O3/c20-16-4-3-12(18(25)24-6-5-14(10-24)23-19(26)27)7-15(16)11-1-2-13(9-22)17(21)8-11/h1-4,7-8,14,23H,5-6,10H2,(H,26,27)/t14-/m0/s1 |
| InChIKey | HUFSLIRNFFVQRX-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |