C16H19ClN4O2 — CID 146109714
3-[1-(4-chloro-3-cyanobenzoyl)piperidin-4-yl]-1,1-dimethylurea (PubChem CID 146109714) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 3-[1-(4-chloro-3-cyanobenzoyl)piperidin-4-yl]-1,1-dimethylurea.
| Compound Name | 3-[1-(4-chloro-3-cyanobenzoyl)piperidin-4-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 146109714 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-[1-(4-chloro-3-cyanobenzoyl)piperidin-4-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1CCN(C(=O)c2ccc(Cl)c(C#N)c2)CC1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-20(2)16(23)19-13-5-7-21(8-6-13)15(22)11-3-4-14(17)12(9-11)10-18/h3-4,9,13H,5-8H2,1-2H3,(H,19,23) |
| InChIKey | RIJMHRUVGZYITO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |