C18H19F3N4O4 — CID 156881467
N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide;methoxymethane (PubChem CID 156881467) has the molecular formula C18H19F3N4O4 and a molecular weight of 412.37 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide;methoxymethane.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide;methoxymethane |
|---|---|
| PubChem CID | 156881467 |
| Molecular Formula | C18H19F3N4O4 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3-oxazole-2-carboxamide;methoxymethane |
| SMILES | COC.N#CN1CCC(NC(=O)c2ncc(-c3cccc(OC(F)(F)F)c3)o2)C1 |
| InChI | InChI=1S/C16H13F3N4O3.C2H6O/c17-16(18,19)26-12-3-1-2-10(6-12)13-7-21-15(25-13)14(24)22-11-4-5-23(8-11)9-20;1-3-2/h1-3,6-7,11H,4-5,8H2,(H,22,24);1-2H3 |
| InChIKey | QNLCNTFXPZRYMX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|