C17H17F3N4O3 — CID 139001144
2-methoxy-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyrimidine-5-carboxamide (PubChem CID 139001144) has the molecular formula C17H17F3N4O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is 2-methoxy-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-methoxy-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 139001144 |
| Molecular Formula | C17H17F3N4O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-methoxy-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyrimidine-5-carboxamide |
| SMILES | COc1ncc(C(=O)NC2CCN(c3cccc(OC(F)(F)F)c3)C2)cn1 |
| InChI | InChI=1S/C17H17F3N4O3/c1-26-16-21-8-11(9-22-16)15(25)23-12-5-6-24(10-12)13-3-2-4-14(7-13)27-17(18,19)20/h2-4,7-9,12H,5-6,10H2,1H3,(H,23,25) |
| InChIKey | MAQLUKYFZHHFAN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |