C17H22F3N3O2 — CID 119886059
N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]piperidine-3-carboxamide (PubChem CID 119886059) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119886059 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CCN(c2cccc(OC(F)(F)F)c2)C1)C1CCCNC1 |
| InChI | InChI=1S/C17H22F3N3O2/c18-17(19,20)25-15-5-1-4-14(9-15)23-8-6-13(11-23)22-16(24)12-3-2-7-21-10-12/h1,4-5,9,12-13,21H,2-3,6-8,10-11H2,(H,22,24) |
| InChIKey | SCSJVYWKBNKKTA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |