C14H17F4N3O2 — CID 125140707
1-(2-fluoroethyl)-3-[(3S)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]urea (PubChem CID 125140707) has the molecular formula C14H17F4N3O2 and a molecular weight of 335.30 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-[(3S)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]urea.
| Compound Name | 1-(2-fluoroethyl)-3-[(3S)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 125140707 |
| Molecular Formula | C14H17F4N3O2 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-(2-fluoroethyl)-3-[(3S)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]urea |
| SMILES | O=C(NCCF)N[C@H]1CCN(c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H17F4N3O2/c15-5-6-19-13(22)20-10-4-7-21(9-10)11-2-1-3-12(8-11)23-14(16,17)18/h1-3,8,10H,4-7,9H2,(H2,19,20,22)/t10-/m0/s1 |
| InChIKey | SRMMZVTUVKTBLR-JTQLQIEISA-N |
| XLogP | 2.43 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |