C20H22F3N3O2 — CID 120613181
3-(2-aminophenyl)-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]propanamide (PubChem CID 120613181) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 120613181 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]propanamide |
| SMILES | Nc1ccccc1CCC(=O)NC1CCN(c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H22F3N3O2/c21-20(22,23)28-17-6-3-5-16(12-17)26-11-10-15(13-26)25-19(27)9-8-14-4-1-2-7-18(14)24/h1-7,12,15H,8-11,13,24H2,(H,25,27) |
| InChIKey | SFXJVJKJZJPWMF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|