C19H22BrN3O — CID 120612958
3-(2-aminophenyl)-N-[1-(4-bromophenyl)pyrrolidin-3-yl]propanamide (PubChem CID 120612958) has the molecular formula C19H22BrN3O and a molecular weight of 388.31 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(4-bromophenyl)pyrrolidin-3-yl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[1-(4-bromophenyl)pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 120612958 |
| Molecular Formula | C19H22BrN3O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(4-bromophenyl)pyrrolidin-3-yl]propanamide |
| SMILES | Nc1ccccc1CCC(=O)NC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H22BrN3O/c20-15-6-8-17(9-7-15)23-12-11-16(13-23)22-19(24)10-5-14-3-1-2-4-18(14)21/h1-4,6-9,16H,5,10-13,21H2,(H,22,24) |
| InChIKey | IGASWBNVSJIFMI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|