C16H24Cl3N3O — CID 119899482
N-[1-(3-chlorophenyl)pyrrolidin-3-yl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119899482) has the molecular formula C16H24Cl3N3O and a molecular weight of 380.75 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)pyrrolidin-3-yl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[1-(3-chlorophenyl)pyrrolidin-3-yl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119899482 |
| Molecular Formula | C16H24Cl3N3O |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[1-(3-chlorophenyl)pyrrolidin-3-yl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCN(c2cccc(Cl)c2)C1)C1CCCNC1 |
| InChI | InChI=1S/C16H22ClN3O.2ClH/c17-13-4-1-5-15(9-13)20-8-6-14(11-20)19-16(21)12-3-2-7-18-10-12;;/h1,4-5,9,12,14,18H,2-3,6-8,10-11H2,(H,19,21);2*1H |
| InChIKey | RMOUOIUAJMMDEE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |