C17H26Cl3N3O — CID 119899510
3-amino-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]cyclohexane-1-carboxamide;dihydrochloride (PubChem CID 119899510) has the molecular formula C17H26Cl3N3O and a molecular weight of 394.77 g/mol. Its IUPAC name is 3-amino-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]cyclohexane-1-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]cyclohexane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119899510 |
| Molecular Formula | C17H26Cl3N3O |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-amino-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]cyclohexane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCC(C(=O)NC2CCN(c3cccc(Cl)c3)C2)C1 |
| InChI | InChI=1S/C17H24ClN3O.2ClH/c18-13-4-2-6-16(10-13)21-8-7-15(11-21)20-17(22)12-3-1-5-14(19)9-12;;/h2,4,6,10,12,14-15H,1,3,5,7-9,11,19H2,(H,20,22);2*1H |
| InChIKey | JOJRJIRODNZHSE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |