C18H17ClF3N3O3 — CID 90633900
N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3-(trifluoromethoxy)benzamide (PubChem CID 90633900) has the molecular formula C18H17ClF3N3O3 and a molecular weight of 415.80 g/mol. Its IUPAC name is N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3-(trifluoromethoxy)benzamide.
| Compound Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 90633900 |
| Molecular Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3-(trifluoromethoxy)benzamide |
| SMILES | O=C(NC1CCC(Oc2ncc(Cl)cn2)CC1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H17ClF3N3O3/c19-12-9-23-17(24-10-12)27-14-6-4-13(5-7-14)25-16(26)11-2-1-3-15(8-11)28-18(20,21)22/h1-3,8-10,13-14H,4-7H2,(H,25,26) |
| InChIKey | YLDZCBXVUCBPRC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |