C21H25ClN4O3 — CID 90633915
N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-4-morpholin-4-ylbenzamide (PubChem CID 90633915) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-4-morpholin-4-ylbenzamide.
| Compound Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 90633915 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-4-morpholin-4-ylbenzamide |
| SMILES | O=C(NC1CCC(Oc2ncc(Cl)cn2)CC1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25ClN4O3/c22-16-13-23-21(24-14-16)29-19-7-3-17(4-8-19)25-20(27)15-1-5-18(6-2-15)26-9-11-28-12-10-26/h1-2,5-6,13-14,17,19H,3-4,7-12H2,(H,25,27) |
| InChIKey | YNZDCUHSCFXYAN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |