C17H16ClF2N3O2 — CID 90633706
N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4-difluorobenzamide (PubChem CID 90633706) has the molecular formula C17H16ClF2N3O2 and a molecular weight of 367.78 g/mol. Its IUPAC name is N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4-difluorobenzamide.
| Compound Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 90633706 |
| Molecular Formula | C17H16ClF2N3O2 |
| Molecular Weight | 367.78 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[4-(5-chloropyrimidin-2-yl)oxycyclohexyl]-3,4-difluorobenzamide |
| SMILES | O=C(NC1CCC(Oc2ncc(Cl)cn2)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H16ClF2N3O2/c18-11-8-21-17(22-9-11)25-13-4-2-12(3-5-13)23-16(24)10-1-6-14(19)15(20)7-10/h1,6-9,12-13H,2-5H2,(H,23,24) |
| InChIKey | CZSYFCJIUHLRIW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |